C16H25FN2O3 — CID 111423789
1-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 111423789) has the molecular formula C16H25FN2O3 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 111423789 |
| Molecular Formula | C16H25FN2O3 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[[2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CN(CC(O)CN1CCOCC1)CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H25FN2O3/c1-18(10-15(20)11-19-6-8-22-9-7-19)12-16(21)13-2-4-14(17)5-3-13/h2-5,15-16,20-21H,6-12H2,1H3 |
| InChIKey | ZZZSXQOJXIDIHW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |