C17H29N3O2 — CID 111916375
1-[[2-(dimethylamino)phenyl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 111916375) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)phenyl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[[2-(dimethylamino)phenyl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 111916375 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-[[2-(dimethylamino)phenyl]methyl-methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CN(Cc1ccccc1N(C)C)CC(O)CN1CCOCC1 |
| InChI | InChI=1S/C17H29N3O2/c1-18(2)17-7-5-4-6-15(17)12-19(3)13-16(21)14-20-8-10-22-11-9-20/h4-7,16,21H,8-14H2,1-3H3 |
| InChIKey | RBVFDPKWTHRETK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |