C12H18BrNO2 — CID 110935898
1-(4-bromophenyl)-2-[2-methoxyethyl(methyl)amino]ethanol (PubChem CID 110935898) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[2-methoxyethyl(methyl)amino]ethanol.
| Compound Name | 1-(4-bromophenyl)-2-[2-methoxyethyl(methyl)amino]ethanol |
|---|---|
| PubChem CID | 110935898 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(4-bromophenyl)-2-[2-methoxyethyl(methyl)amino]ethanol |
| SMILES | COCCN(C)CC(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H18BrNO2/c1-14(7-8-16-2)9-12(15)10-3-5-11(13)6-4-10/h3-6,12,15H,7-9H2,1-2H3 |
| InChIKey | VADCZCVMBUTBLJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |