C10H12F2OS — CID 115659400
2-[(3,4-difluorophenyl)methylsulfanyl]propan-1-ol (PubChem CID 115659400) has the molecular formula C10H12F2OS and a molecular weight of 218.27 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methylsulfanyl]propan-1-ol.
| Compound Name | 2-[(3,4-difluorophenyl)methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 115659400 |
| Molecular Formula | C10H12F2OS |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methylsulfanyl]propan-1-ol |
| SMILES | CC(CO)SCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H12F2OS/c1-7(5-13)14-6-8-2-3-9(11)10(12)4-8/h2-4,7,13H,5-6H2,1H3 |
| InChIKey | GHAMJMBQVTWMMI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |