C8H8F2S — CID 89093376
1,2-difluoro-4-(methylsulfanylmethyl)benzene (PubChem CID 89093376) has the molecular formula C8H8F2S and a molecular weight of 174.21 g/mol. Its IUPAC name is 1,2-difluoro-4-(methylsulfanylmethyl)benzene.
| Compound Name | 1,2-difluoro-4-(methylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 89093376 |
| Molecular Formula | C8H8F2S |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 1,2-difluoro-4-(methylsulfanylmethyl)benzene |
| SMILES | CSCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H8F2S/c1-11-5-6-2-3-7(9)8(10)4-6/h2-4H,5H2,1H3 |
| InChIKey | VFCGKWDYWIUFCG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |