C10H12ClFO — CID 114852176
1-(4-chloro-2-fluorophenyl)butan-2-ol (PubChem CID 114852176) has the molecular formula C10H12ClFO and a molecular weight of 202.66 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)butan-2-ol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 114852176 |
| Molecular Formula | C10H12ClFO |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)butan-2-ol |
| SMILES | CCC(O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C10H12ClFO/c1-2-9(13)5-7-3-4-8(11)6-10(7)12/h3-4,6,9,13H,2,5H2,1H3 |
| InChIKey | CEFYOCKBNKRLBR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |