C15H13BrF2OS — CID 66145226
1-(2-bromophenyl)sulfanyl-3-(2,5-difluorophenyl)propan-2-ol (PubChem CID 66145226) has the molecular formula C15H13BrF2OS and a molecular weight of 359.24 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanyl-3-(2,5-difluorophenyl)propan-2-ol.
| Compound Name | 1-(2-bromophenyl)sulfanyl-3-(2,5-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 66145226 |
| Molecular Formula | C15H13BrF2OS |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 1-(2-bromophenyl)sulfanyl-3-(2,5-difluorophenyl)propan-2-ol |
| SMILES | OC(CSc1ccccc1Br)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C15H13BrF2OS/c16-13-3-1-2-4-15(13)20-9-12(19)8-10-7-11(17)5-6-14(10)18/h1-7,12,19H,8-9H2 |
| InChIKey | HGVJKXINXNOHIH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |