C17H18F2O — CID 63893918
2-(2,5-difluorophenyl)-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 63893918) has the molecular formula C17H18F2O and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 2-(2,5-difluorophenyl)-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 63893918 |
| Molecular Formula | C17H18F2O |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C(O)Cc2cc(F)ccc2F)c(C)c1 |
| InChI | InChI=1S/C17H18F2O/c1-10-6-11(2)17(12(3)7-10)16(20)9-13-8-14(18)4-5-15(13)19/h4-8,16,20H,9H2,1-3H3 |
| InChIKey | UAXVHXNTAOXVPB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |