C15H16F2O2 — CID 114981981
2-(2,5-difluorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol (PubChem CID 114981981) has the molecular formula C15H16F2O2 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol.
| Compound Name | 2-(2,5-difluorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol |
|---|---|
| PubChem CID | 114981981 |
| Molecular Formula | C15H16F2O2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol |
| SMILES | Cc1oc(C)c(C(O)Cc2cc(F)ccc2F)c1C |
| InChI | InChI=1S/C15H16F2O2/c1-8-9(2)19-10(3)15(8)14(18)7-11-6-12(16)4-5-13(11)17/h4-6,14,18H,7H2,1-3H3 |
| InChIKey | VQKPXOHXSQNLEL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |