C12H14F2O2 — CID 103456708
1-cyclopropyl-3-(2,5-difluorophenyl)propane-1,2-diol (PubChem CID 103456708) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,5-difluorophenyl)propane-1,2-diol.
| Compound Name | 1-cyclopropyl-3-(2,5-difluorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 103456708 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-cyclopropyl-3-(2,5-difluorophenyl)propane-1,2-diol |
| SMILES | OC(Cc1cc(F)ccc1F)C(O)C1CC1 |
| InChI | InChI=1S/C12H14F2O2/c13-9-3-4-10(14)8(5-9)6-11(15)12(16)7-1-2-7/h3-5,7,11-12,15-16H,1-2,6H2 |
| InChIKey | LVQBIZIIKKOCKT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |