C13H15F3O — CID 62620644
3-methyl-1-(3,4,5-trifluorophenyl)hexan-1-one (PubChem CID 62620644) has the molecular formula C13H15F3O and a molecular weight of 244.26 g/mol. Its IUPAC name is 3-methyl-1-(3,4,5-trifluorophenyl)hexan-1-one.
| Compound Name | 3-methyl-1-(3,4,5-trifluorophenyl)hexan-1-one |
|---|---|
| PubChem CID | 62620644 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-methyl-1-(3,4,5-trifluorophenyl)hexan-1-one |
| SMILES | CCCC(C)CC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H15F3O/c1-3-4-8(2)5-12(17)9-6-10(14)13(16)11(15)7-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | VPFQEFWDGCCGQU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|