C16H9F9 — CID 170246537
1-(2,4-difluoro-6-propan-2-ylphenyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene (PubChem CID 170246537) has the molecular formula C16H9F9 and a molecular weight of 372.23 g/mol. Its IUPAC name is 1-(2,4-difluoro-6-propan-2-ylphenyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene.
| Compound Name | 1-(2,4-difluoro-6-propan-2-ylphenyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 170246537 |
| Molecular Formula | C16H9F9 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 1-(2,4-difluoro-6-propan-2-ylphenyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
| SMILES | CC(C)c1cc(F)cc(F)c1-c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C16H9F9/c1-5(2)7-3-6(17)4-8(18)9(7)10-12(19)14(21)11(16(23,24)25)15(22)13(10)20/h3-5H,1-2H3 |
| InChIKey | RLMYUBMLOZHFRB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|