C28H8F14O — CID 88877460
10-(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoro-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene (PubChem CID 88877460) has the molecular formula C28H8F14O and a molecular weight of 626.34 g/mol. Its IUPAC name is 10-(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoro-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene.
| Compound Name | 10-(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoro-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 88877460 |
| Molecular Formula | C28H8F14O |
| Molecular Weight | 626.34 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 10-(2,6-difluoro-4-methoxyphenyl)-1,2,3,4,6-pentafluoro-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene |
| SMILES | COc1cc(F)c(-c2c3cc(F)ccc3c(-c3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3c(F)c(F)c(F)c(F)c23)c(F)c1 |
| InChI | InChI=1S/C28H8F14O/c1-43-8-5-11(30)15(12(31)6-8)14-10-4-7(29)2-3-9(10)13(16-17(14)21(33)27(39)26(38)20(16)32)18-22(34)24(36)19(28(40,41)42)25(37)23(18)35/h2-6H,1H3 |
| InChIKey | KVBVQJFHEQIFHN-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.34 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|