C27H11F9O — CID 87426004
9-(2,6-difluoro-4-methoxyphenyl)-2,3-difluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene (PubChem CID 87426004) has the molecular formula C27H11F9O and a molecular weight of 522.37 g/mol. Its IUPAC name is 9-(2,6-difluoro-4-methoxyphenyl)-2,3-difluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene.
| Compound Name | 9-(2,6-difluoro-4-methoxyphenyl)-2,3-difluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene |
|---|---|
| PubChem CID | 87426004 |
| Molecular Formula | C27H11F9O |
| Molecular Weight | 522.37 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 9-(2,6-difluoro-4-methoxyphenyl)-2,3-difluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene |
| SMILES | COc1cc(F)c(-c2c3ccccc3c(-c3c(F)c(F)c(F)c(F)c3F)c3cc(F)c(F)cc23)c(F)c1 |
| InChI | InChI=1S/C27H11F9O/c1-37-10-6-17(30)21(18(31)7-10)19-11-4-2-3-5-12(11)20(14-9-16(29)15(28)8-13(14)19)22-23(32)25(34)27(36)26(35)24(22)33/h2-9H,1H3 |
| InChIKey | IFUFOCTXUYFWCM-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.37 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|