C27H12F8O — CID 87426010
10-(2,6-difluoro-4-methoxyphenyl)-1,6,7-trifluoro-9-(3,4,5-trifluorophenyl)anthracene (PubChem CID 87426010) has the molecular formula C27H12F8O and a molecular weight of 504.38 g/mol. Its IUPAC name is 10-(2,6-difluoro-4-methoxyphenyl)-1,6,7-trifluoro-9-(3,4,5-trifluorophenyl)anthracene.
| Compound Name | 10-(2,6-difluoro-4-methoxyphenyl)-1,6,7-trifluoro-9-(3,4,5-trifluorophenyl)anthracene |
|---|---|
| PubChem CID | 87426010 |
| Molecular Formula | C27H12F8O |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 10-(2,6-difluoro-4-methoxyphenyl)-1,6,7-trifluoro-9-(3,4,5-trifluorophenyl)anthracene |
| SMILES | COc1cc(F)c(-c2c3cc(F)c(F)cc3c(-c3cc(F)c(F)c(F)c3)c3c(F)cccc23)c(F)c1 |
| InChI | InChI=1S/C27H12F8O/c1-36-12-7-19(31)26(20(32)8-12)24-13-3-2-4-16(28)25(13)23(11-5-21(33)27(35)22(34)6-11)14-9-17(29)18(30)10-15(14)24/h2-10H,1H3 |
| InChIKey | SQDLXYHLVOYWBJ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|