C26H10F8 — CID 87428392
9-(3,4-difluorophenyl)-1-fluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene (PubChem CID 87428392) has the molecular formula C26H10F8 and a molecular weight of 474.35 g/mol. Its IUPAC name is 9-(3,4-difluorophenyl)-1-fluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene.
| Compound Name | 9-(3,4-difluorophenyl)-1-fluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene |
|---|---|
| PubChem CID | 87428392 |
| Molecular Formula | C26H10F8 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 9-(3,4-difluorophenyl)-1-fluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene |
| SMILES | Fc1ccc(-c2c3ccccc3c(-c3c(F)c(F)c(F)c(F)c3F)c3cccc(F)c23)cc1F |
| InChI | InChI=1S/C26H10F8/c27-15-9-8-11(10-17(15)29)18-12-4-1-2-5-13(12)19(14-6-3-7-16(28)20(14)18)21-22(30)24(32)26(34)25(33)23(21)31/h1-10H |
| InChIKey | QWXWIRZRSQYFAF-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|