C26H6F12 — CID 87428689
1,4-difluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene (PubChem CID 87428689) has the molecular formula C26H6F12 and a molecular weight of 546.31 g/mol. Its IUPAC name is 1,4-difluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene.
| Compound Name | 1,4-difluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene |
|---|---|
| PubChem CID | 87428689 |
| Molecular Formula | C26H6F12 |
| Molecular Weight | 546.31 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | 1,4-difluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene |
| SMILES | Fc1c(F)c(F)c(-c2c3ccccc3c(-c3c(F)c(F)c(F)c(F)c3F)c3c(F)ccc(F)c23)c(F)c1F |
| InChI | InChI=1S/C26H6F12/c27-9-5-6-10(28)14-12(16-19(31)23(35)26(38)24(36)20(16)32)8-4-2-1-3-7(8)11(13(9)14)15-17(29)21(33)25(37)22(34)18(15)30/h1-6H |
| InChIKey | HCDTZAIYMWECLK-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.31 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|