C36H12F12 — CID 118672915
9-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene (PubChem CID 118672915) has the molecular formula C36H12F12 and a molecular weight of 672.47 g/mol. Its IUPAC name is 9-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene.
| Compound Name | 9-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene |
|---|---|
| PubChem CID | 118672915 |
| Molecular Formula | C36H12F12 |
| Molecular Weight | 672.47 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | 9-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene |
| SMILES | Fc1c(F)c(F)c(-c2ccc(-c3c4ccccc4c(-c4c(F)c(F)c(F)c5c(F)c(F)c(F)c(F)c45)c4ccccc34)cc2)c(F)c1F |
| InChI | InChI=1S/C36H12F12/c37-25-20(26(38)33(45)36(48)32(25)44)14-11-9-13(10-12-14)19-15-5-1-3-7-17(15)21(18-8-4-2-6-16(18)19)22-23-24(29(41)31(43)27(22)39)30(42)35(47)34(46)28(23)40/h1-12H |
| InChIKey | LKRTUTSJDNJCBW-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.47 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|