C24H14F5N — CID 102107695
4-(2,3,4,5,6-pentafluorophenyl)-N,N-diphenylaniline (PubChem CID 102107695) has the molecular formula C24H14F5N and a molecular weight of 411.37 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)-N,N-diphenylaniline.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102107695 |
| Molecular Formula | C24H14F5N |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)-N,N-diphenylaniline |
| SMILES | Fc1c(F)c(F)c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(F)c1F |
| InChI | InChI=1S/C24H14F5N/c25-20-19(21(26)23(28)24(29)22(20)27)15-11-13-18(14-12-15)30(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
| InChIKey | OKILPOVJKUQGKQ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|