C37H25F4N — CID 163845903
4-phenyl-N-(4-phenylphenyl)-N-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]aniline (PubChem CID 163845903) has the molecular formula C37H25F4N and a molecular weight of 559.61 g/mol. Its IUPAC name is 4-phenyl-N-(4-phenylphenyl)-N-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]aniline.
| Compound Name | 4-phenyl-N-(4-phenylphenyl)-N-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 163845903 |
| Molecular Formula | C37H25F4N |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 4-phenyl-N-(4-phenylphenyl)-N-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]aniline |
| SMILES | Cc1c(F)c(F)c(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C37H25F4N/c1-24-34(38)36(40)33(37(41)35(24)39)29-16-22-32(23-17-29)42(30-18-12-27(13-19-30)25-8-4-2-5-9-25)31-20-14-28(15-21-31)26-10-6-3-7-11-26/h2-23H,1H3 |
| InChIKey | OQCSMNCYEKAGPM-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|