C16H5F7S — CID 177164193
4-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)benzenethiol (PubChem CID 177164193) has the molecular formula C16H5F7S and a molecular weight of 362.27 g/mol. Its IUPAC name is 4-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)benzenethiol.
| Compound Name | 4-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)benzenethiol |
|---|---|
| PubChem CID | 177164193 |
| Molecular Formula | C16H5F7S |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 4-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)benzenethiol |
| SMILES | Fc1c(F)c(F)c2c(F)c(-c3ccc(S)cc3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C16H5F7S/c17-10-7(5-1-3-6(24)4-2-5)11(18)12(19)9-8(10)13(20)15(22)16(23)14(9)21/h1-4,24H |
| InChIKey | LOXWWRRBUATESN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|