C22H5F15OS2 — CID 177164144
4-[2,3,5,6,7,8-hexafluoro-4-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenoxy]naphthalen-1-yl]benzenethiol (PubChem CID 177164144) has the molecular formula C22H5F15OS2 and a molecular weight of 634.39 g/mol. Its IUPAC name is 4-[2,3,5,6,7,8-hexafluoro-4-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenoxy]naphthalen-1-yl]benzenethiol.
| Compound Name | 4-[2,3,5,6,7,8-hexafluoro-4-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenoxy]naphthalen-1-yl]benzenethiol |
|---|---|
| PubChem CID | 177164144 |
| Molecular Formula | C22H5F15OS2 |
| Molecular Weight | 634.39 g/mol |
| Exact Mass | 633.95 |
| IUPAC Name | 4-[2,3,5,6,7,8-hexafluoro-4-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenoxy]naphthalen-1-yl]benzenethiol |
| SMILES | Fc1c(F)c(S(F)(F)(F)(F)F)c(F)c(F)c1Oc1c(F)c(F)c(-c2ccc(S)cc2)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C22H5F15OS2/c23-10-7(5-1-3-6(39)4-2-5)8-9(12(25)14(27)13(26)11(8)24)20(15(10)28)38-21-16(29)18(31)22(19(32)17(21)30)40(33,34,35,36)37/h1-4,39H |
| InChIKey | LPFOSCZSODLMCN-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.39 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|