C54H22F18N2O2 — CID 138724935
1-N,4-N-diphenyl-1-N,4-N-bis[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]benzene-1,4-diamine (PubChem CID 138724935) has the molecular formula C54H22F18N2O2 and a molecular weight of 1072.75 g/mol. Its IUPAC name is 1-N,4-N-diphenyl-1-N,4-N-bis[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-diphenyl-1-N,4-N-bis[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 138724935 |
| Molecular Formula | C54H22F18N2O2 |
| Molecular Weight | 1072.75 g/mol |
| Exact Mass | 1072.14 |
| IUPAC Name | 1-N,4-N-diphenyl-1-N,4-N-bis[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]benzene-1,4-diamine |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(Oc3ccc(N(c4ccccc4)c4ccc(N(c5ccccc5)c5ccc(Oc6c(F)c(F)c(-c7c(F)c(F)c(F)c(F)c7F)c(F)c6F)cc5)cc4)cc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C54H22F18N2O2/c55-35-31(36(56)44(64)47(67)43(35)63)33-39(59)49(69)53(50(70)40(33)60)75-29-19-15-27(16-20-29)73(23-7-3-1-4-8-23)25-11-13-26(14-12-25)74(24-9-5-2-6-10-24)28-17-21-30(22-18-28)76-54-51(71)41(61)34(42(62)52(54)72)32-37(57)45(65)48(68)46(66)38(32)58/h1-22H |
| InChIKey | DYJMKYKOCZZYTI-UHFFFAOYSA-N |
| XLogP | 18.05 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.75 |
| LogP ≤ 5 | 18.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|