C49H30F8N2O2 — CID 138724800
2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[3-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]methyl]phenoxy]phenyl]phenol (PubChem CID 138724800) has the molecular formula C49H30F8N2O2 and a molecular weight of 830.77 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[3-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]methyl]phenoxy]phenyl]phenol.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[3-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]methyl]phenoxy]phenyl]phenol |
|---|---|
| PubChem CID | 138724800 |
| Molecular Formula | C49H30F8N2O2 |
| Molecular Weight | 830.77 g/mol |
| Exact Mass | 830.22 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[3-(N-[4-(N-phenylanilino)phenyl]anilino)phenyl]methyl]phenoxy]phenyl]phenol |
| SMILES | Oc1c(F)c(F)c(-c2c(F)c(F)c(Oc3ccc(Cc4cccc(N(c5ccccc5)c5ccc(N(c6ccccc6)c6ccccc6)cc5)c4)cc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C49H30F8N2O2/c50-40-38(41(51)45(55)48(60)44(40)54)39-42(52)46(56)49(47(57)43(39)53)61-37-25-19-29(20-26-37)27-30-11-10-18-36(28-30)59(33-16-8-3-9-17-33)35-23-21-34(22-24-35)58(31-12-4-1-5-13-31)32-14-6-2-7-15-32/h1-26,28,60H,27H2 |
| InChIKey | XSBNFTVXYMDNNO-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.77 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|