C20H14F7NO — CID 15808266
N,N-diethyl-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxyaniline (PubChem CID 15808266) has the molecular formula C20H14F7NO and a molecular weight of 417.32 g/mol. Its IUPAC name is N,N-diethyl-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxyaniline.
| Compound Name | N,N-diethyl-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxyaniline |
|---|---|
| PubChem CID | 15808266 |
| Molecular Formula | C20H14F7NO |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N,N-diethyl-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxyaniline |
| SMILES | CCN(CC)c1cccc(Oc2c(F)c(F)c3c(F)c(F)c(F)c(F)c3c2F)c1 |
| InChI | InChI=1S/C20H14F7NO/c1-3-28(4-2)9-6-5-7-10(8-9)29-20-16(24)12-11(15(23)19(20)27)13(21)17(25)18(26)14(12)22/h5-8H,3-4H2,1-2H3 |
| InChIKey | AEJHODVCPFXHLC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|