C17H18N2O3S — CID 829194
3-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-N,N-diethylaniline (PubChem CID 829194) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-N,N-diethylaniline.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-N,N-diethylaniline |
|---|---|
| PubChem CID | 829194 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-N,N-diethylaniline |
| SMILES | CCN(CC)c1cccc(OC2=NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C17H18N2O3S/c1-3-19(4-2)13-8-7-9-14(12-13)22-17-15-10-5-6-11-16(15)23(20,21)18-17/h5-12H,3-4H2,1-2H3 |
| InChIKey | OYRDAFOOTKHBNH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |