C9H10N2O3S — CID 62348125
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]ethanamine (PubChem CID 62348125) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]ethanamine.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 62348125 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]ethanamine |
| SMILES | NCCOC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C9H10N2O3S/c10-5-6-14-9-7-3-1-2-4-8(7)15(12,13)11-9/h1-4H,5-6,10H2 |
| InChIKey | CKPYJCDLCNRLIE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |