C14H12N2O3S — CID 61314004
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-5-methylaniline (PubChem CID 61314004) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-5-methylaniline.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-5-methylaniline |
|---|---|
| PubChem CID | 61314004 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-5-methylaniline |
| SMILES | Cc1ccc(OC2=NS(=O)(=O)c3ccccc32)c(N)c1 |
| InChI | InChI=1S/C14H12N2O3S/c1-9-6-7-12(11(15)8-9)19-14-10-4-2-3-5-13(10)20(17,18)16-14/h2-8H,15H2,1H3 |
| InChIKey | ODEWYSQHFVRXAN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|