C14H8F3NO3S — CID 14765032
3-[3-(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide (PubChem CID 14765032) has the molecular formula C14H8F3NO3S and a molecular weight of 327.28 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-[3-(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 14765032 |
| Molecular Formula | C14H8F3NO3S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(Oc2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C14H8F3NO3S/c15-14(16,17)9-4-3-5-10(8-9)21-13-11-6-1-2-7-12(11)22(19,20)18-13/h1-8H |
| InChIKey | NQUYSFWQGLHWFE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |