C10H6F3NO3S — CID 117233743
4-[3-(trifluoromethyl)phenoxy]-1,2-thiazole 1,1-dioxide (PubChem CID 117233743) has the molecular formula C10H6F3NO3S and a molecular weight of 277.22 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenoxy]-1,2-thiazole 1,1-dioxide.
| Compound Name | 4-[3-(trifluoromethyl)phenoxy]-1,2-thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 117233743 |
| Molecular Formula | C10H6F3NO3S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenoxy]-1,2-thiazole 1,1-dioxide |
| SMILES | O=S1(=O)C=C(Oc2cccc(C(F)(F)F)c2)C=N1 |
| InChI | InChI=1S/C10H6F3NO3S/c11-10(12,13)7-2-1-3-8(4-7)17-9-5-14-18(15,16)6-9/h1-6H |
| InChIKey | RRBWIMOKNXKPBD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |