C12H7ClF3NO2S — CID 15104281
2-methyl-4-[3-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbonyl chloride (PubChem CID 15104281) has the molecular formula C12H7ClF3NO2S and a molecular weight of 321.71 g/mol. Its IUPAC name is 2-methyl-4-[3-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbonyl chloride.
| Compound Name | 2-methyl-4-[3-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 15104281 |
| Molecular Formula | C12H7ClF3NO2S |
| Molecular Weight | 321.71 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 2-methyl-4-[3-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbonyl chloride |
| SMILES | Cc1nc(Oc2cccc(C(F)(F)F)c2)c(C(=O)Cl)s1 |
| InChI | InChI=1S/C12H7ClF3NO2S/c1-6-17-11(9(20-6)10(13)18)19-8-4-2-3-7(5-8)12(14,15)16/h2-5H,1H3 |
| InChIKey | RTPIWZFBFAPLEM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|