C17H15F3N2O4 — CID 139654305
3-methoxy-2-[2-methyl-4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]but-2-enoic acid (PubChem CID 139654305) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is 3-methoxy-2-[2-methyl-4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]but-2-enoic acid.
| Compound Name | 3-methoxy-2-[2-methyl-4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 139654305 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-methoxy-2-[2-methyl-4-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]but-2-enoic acid |
| SMILES | COC(C)=C(C(=O)O)c1cnc(C)nc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N2O4/c1-9(25-3)14(16(23)24)13-8-21-10(2)22-15(13)26-12-6-4-5-11(7-12)17(18,19)20/h4-8H,1-3H3,(H,23,24) |
| InChIKey | HGZAANGTBCLCQQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|