C14H14F3N3O — CID 80874515
N,2,5-trimethyl-6-[3-(trifluoromethyl)phenoxy]pyrimidin-4-amine (PubChem CID 80874515) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is N,2,5-trimethyl-6-[3-(trifluoromethyl)phenoxy]pyrimidin-4-amine.
| Compound Name | N,2,5-trimethyl-6-[3-(trifluoromethyl)phenoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80874515 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N,2,5-trimethyl-6-[3-(trifluoromethyl)phenoxy]pyrimidin-4-amine |
| SMILES | CNc1nc(C)nc(Oc2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C14H14F3N3O/c1-8-12(18-3)19-9(2)20-13(8)21-11-6-4-5-10(7-11)14(15,16)17/h4-7H,1-3H3,(H,18,19,20) |
| InChIKey | JPLCUGLXBVZILR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |