C13H10F3N3O3 — CID 175592283
2,4-dimethyl-5-nitro-6-[3-(trifluoromethyl)phenoxy]pyrimidine (PubChem CID 175592283) has the molecular formula C13H10F3N3O3 and a molecular weight of 313.24 g/mol. Its IUPAC name is 2,4-dimethyl-5-nitro-6-[3-(trifluoromethyl)phenoxy]pyrimidine.
| Compound Name | 2,4-dimethyl-5-nitro-6-[3-(trifluoromethyl)phenoxy]pyrimidine |
|---|---|
| PubChem CID | 175592283 |
| Molecular Formula | C13H10F3N3O3 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2,4-dimethyl-5-nitro-6-[3-(trifluoromethyl)phenoxy]pyrimidine |
| SMILES | Cc1nc(C)c([N+](=O)[O-])c(Oc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H10F3N3O3/c1-7-11(19(20)21)12(18-8(2)17-7)22-10-5-3-4-9(6-10)13(14,15)16/h3-6H,1-2H3 |
| InChIKey | AKPOBJDGPCENET-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|