C12H6F3N2O3- — CID 6930221
3-[3-(trifluoromethyl)phenoxy]pyrazine-2-carboxylate (PubChem CID 6930221) has the molecular formula C12H6F3N2O3- and a molecular weight of 283.19 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenoxy]pyrazine-2-carboxylate.
| Compound Name | 3-[3-(trifluoromethyl)phenoxy]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 6930221 |
| Molecular Formula | C12H6F3N2O3- |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenoxy]pyrazine-2-carboxylate |
| SMILES | O=C([O-])c1nccnc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H7F3N2O3/c13-12(14,15)7-2-1-3-8(6-7)20-10-9(11(18)19)16-4-5-17-10/h1-6H,(H,18,19)/p-1 |
| InChIKey | QCVLWOOQXHZABF-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |