C18H14F3NO — CID 71178034
5,6-dimethyl-1-[3-(trifluoromethyl)phenoxy]isoquinoline (PubChem CID 71178034) has the molecular formula C18H14F3NO and a molecular weight of 317.31 g/mol. Its IUPAC name is 5,6-dimethyl-1-[3-(trifluoromethyl)phenoxy]isoquinoline.
| Compound Name | 5,6-dimethyl-1-[3-(trifluoromethyl)phenoxy]isoquinoline |
|---|---|
| PubChem CID | 71178034 |
| Molecular Formula | C18H14F3NO |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 5,6-dimethyl-1-[3-(trifluoromethyl)phenoxy]isoquinoline |
| SMILES | Cc1ccc2c(Oc3cccc(C(F)(F)F)c3)nccc2c1C |
| InChI | InChI=1S/C18H14F3NO/c1-11-6-7-16-15(12(11)2)8-9-22-17(16)23-14-5-3-4-13(10-14)18(19,20)21/h3-10H,1-2H3 |
| InChIKey | TUMVOATUIIAZQE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |