C19H14F3N3O2 — CID 15614422
N-(4-methyl-2-pyridinyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide (PubChem CID 15614422) has the molecular formula C19H14F3N3O2 and a molecular weight of 373.33 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide.
| Compound Name | N-(4-methyl-2-pyridinyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 15614422 |
| Molecular Formula | C19H14F3N3O2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide |
| SMILES | Cc1ccnc(NC(=O)c2cccnc2Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H14F3N3O2/c1-12-7-9-23-16(10-12)25-17(26)15-6-3-8-24-18(15)27-14-5-2-4-13(11-14)19(20,21)22/h2-11H,1H3,(H,23,25,26) |
| InChIKey | UREJHYZZCDGBDX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |