C19H14F3N3O4S — CID 44759446
N-(4-sulfamoylphenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide (PubChem CID 44759446) has the molecular formula C19H14F3N3O4S and a molecular weight of 437.40 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 44759446 |
| Molecular Formula | C19H14F3N3O4S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cccnc2Oc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H14F3N3O4S/c20-19(21,22)12-3-1-4-14(11-12)29-18-16(5-2-10-24-18)17(26)25-13-6-8-15(9-7-13)30(23,27)28/h1-11H,(H,25,26)(H2,23,27,28) |
| InChIKey | CCZKTWZGLXINIW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |