C20H17N7O4S — CID 22612103
N-[(4-sulfamoylphenyl)methyl]-2-[3-(tetrazol-1-yl)phenoxy]pyridine-3-carboxamide (PubChem CID 22612103) has the molecular formula C20H17N7O4S and a molecular weight of 451.47 g/mol. Its IUPAC name is N-[(4-sulfamoylphenyl)methyl]-2-[3-(tetrazol-1-yl)phenoxy]pyridine-3-carboxamide.
| Compound Name | N-[(4-sulfamoylphenyl)methyl]-2-[3-(tetrazol-1-yl)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22612103 |
| Molecular Formula | C20H17N7O4S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-[(4-sulfamoylphenyl)methyl]-2-[3-(tetrazol-1-yl)phenoxy]pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cccnc2Oc2cccc(-n3cnnn3)c2)cc1 |
| InChI | InChI=1S/C20H17N7O4S/c21-32(29,30)17-8-6-14(7-9-17)12-23-19(28)18-5-2-10-22-20(18)31-16-4-1-3-15(11-16)27-13-24-25-26-27/h1-11,13H,12H2,(H,23,28)(H2,21,29,30) |
| InChIKey | POSGOMNXPMLQAF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 154.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |