C14H11FN6O3S — CID 47068482
N-(3-fluoro-5-sulfamoylphenyl)-3-(tetrazol-1-yl)benzamide (PubChem CID 47068482) has the molecular formula C14H11FN6O3S and a molecular weight of 362.35 g/mol. Its IUPAC name is N-(3-fluoro-5-sulfamoylphenyl)-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-(3-fluoro-5-sulfamoylphenyl)-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 47068482 |
| Molecular Formula | C14H11FN6O3S |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-(3-fluoro-5-sulfamoylphenyl)-3-(tetrazol-1-yl)benzamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(NC(=O)c2cccc(-n3cnnn3)c2)c1 |
| InChI | InChI=1S/C14H11FN6O3S/c15-10-5-11(7-13(6-10)25(16,23)24)18-14(22)9-2-1-3-12(4-9)21-8-17-19-20-21/h1-8H,(H,18,22)(H2,16,23,24) |
| InChIKey | UKRADEHGVIOZPR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |