C13H4F5NO3S — CID 71319120
3-(2,3,4,5,6-pentafluorophenoxy)-1,2-benzothiazole 1,1-dioxide (PubChem CID 71319120) has the molecular formula C13H4F5NO3S and a molecular weight of 349.24 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenoxy)-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenoxy)-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 71319120 |
| Molecular Formula | C13H4F5NO3S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenoxy)-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(Oc2c(F)c(F)c(F)c(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C13H4F5NO3S/c14-7-8(15)10(17)12(11(18)9(7)16)22-13-5-3-1-2-4-6(5)23(20,21)19-13/h1-4H |
| InChIKey | YDBTZOOFIPGGBL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|