C20H18N2O6S2 — CID 67576811
3-prop-2-enoxy-1,2-benzothiazole 1,1-dioxide (PubChem CID 67576811) has the molecular formula C20H18N2O6S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-prop-2-enoxy-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-prop-2-enoxy-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 67576811 |
| Molecular Formula | C20H18N2O6S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 3-prop-2-enoxy-1,2-benzothiazole 1,1-dioxide |
| SMILES | C=CCOC1=NS(=O)(=O)c2ccccc21.C=CCOC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/2C10H9NO3S/c2*1-2-7-14-10-8-5-3-4-6-9(8)15(12,13)11-10/h2*2-6H,1,7H2 |
| InChIKey | MMPBHYAQJQCKHZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|