C13H16N2O3S — CID 94407341
3-[[(2R)-piperidin-2-yl]methoxy]-1,2-benzothiazole 1,1-dioxide (PubChem CID 94407341) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-[[(2R)-piperidin-2-yl]methoxy]-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-[[(2R)-piperidin-2-yl]methoxy]-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 94407341 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-[[(2R)-piperidin-2-yl]methoxy]-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(OC[C@H]2CCCCN2)c2ccccc21 |
| InChI | InChI=1S/C13H16N2O3S/c16-19(17)12-7-2-1-6-11(12)13(15-19)18-9-10-5-3-4-8-14-10/h1-2,6-7,10,14H,3-5,8-9H2/t10-/m1/s1 |
| InChIKey | FUGUFSKSYLYBSM-SNVBAGLBSA-N |
| XLogP | 1.29 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |