C11H12N2O3S — CID 62348780
3-pyrrolidin-3-yloxy-1,2-benzothiazole 1,1-dioxide (PubChem CID 62348780) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-pyrrolidin-3-yloxy-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-pyrrolidin-3-yloxy-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 62348780 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3-pyrrolidin-3-yloxy-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(OC2CCNC2)c2ccccc21 |
| InChI | InChI=1S/C11H12N2O3S/c14-17(15)10-4-2-1-3-9(10)11(13-17)16-8-5-6-12-7-8/h1-4,8,12H,5-7H2 |
| InChIKey | QPOSEPKBDGYQLQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |