C14H19N3O2S — CID 63304311
1,1-dioxo-N-propyl-N-pyrrolidin-3-yl-1,2-benzothiazol-3-amine (PubChem CID 63304311) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1,1-dioxo-N-propyl-N-pyrrolidin-3-yl-1,2-benzothiazol-3-amine.
| Compound Name | 1,1-dioxo-N-propyl-N-pyrrolidin-3-yl-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 63304311 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1,1-dioxo-N-propyl-N-pyrrolidin-3-yl-1,2-benzothiazol-3-amine |
| SMILES | CCCN(C1=NS(=O)(=O)c2ccccc21)C1CCNC1 |
| InChI | InChI=1S/C14H19N3O2S/c1-2-9-17(11-7-8-15-10-11)14-12-5-3-4-6-13(12)20(18,19)16-14/h3-6,11,15H,2,7-10H2,1H3 |
| InChIKey | MRHLWDMDNVLNRA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |