C11H17ClN2O2 — CID 71646420
2-(piperidin-2-ylmethoxy)pyridin-3-ol;hydrochloride (PubChem CID 71646420) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-(piperidin-2-ylmethoxy)pyridin-3-ol;hydrochloride.
| Compound Name | 2-(piperidin-2-ylmethoxy)pyridin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 71646420 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(piperidin-2-ylmethoxy)pyridin-3-ol;hydrochloride |
| SMILES | Cl.Oc1cccnc1OCC1CCCCN1 |
| InChI | InChI=1S/C11H16N2O2.ClH/c14-10-5-3-7-13-11(10)15-8-9-4-1-2-6-12-9;/h3,5,7,9,12,14H,1-2,4,6,8H2;1H |
| InChIKey | OHGYZGWKOYINJL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |