C11H16N2O2 — CID 71646429
2-(piperidin-4-ylmethoxy)pyridin-3-ol (PubChem CID 71646429) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(piperidin-4-ylmethoxy)pyridin-3-ol.
| Compound Name | 2-(piperidin-4-ylmethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 71646429 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(piperidin-4-ylmethoxy)pyridin-3-ol |
| SMILES | Oc1cccnc1OCC1CCNCC1 |
| InChI | InChI=1S/C11H16N2O2/c14-10-2-1-5-13-11(10)15-8-9-3-6-12-7-4-9/h1-2,5,9,12,14H,3-4,6-8H2 |
| InChIKey | INEBUECEXWGAQF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |