C16H17N3O — CID 82569770
1-(piperidin-4-ylmethoxy)isoquinoline-5-carbonitrile (PubChem CID 82569770) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(piperidin-4-ylmethoxy)isoquinoline-5-carbonitrile.
| Compound Name | 1-(piperidin-4-ylmethoxy)isoquinoline-5-carbonitrile |
|---|---|
| PubChem CID | 82569770 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-(piperidin-4-ylmethoxy)isoquinoline-5-carbonitrile |
| SMILES | N#Cc1cccc2c(OCC3CCNCC3)nccc12 |
| InChI | InChI=1S/C16H17N3O/c17-10-13-2-1-3-15-14(13)6-9-19-16(15)20-11-12-4-7-18-8-5-12/h1-3,6,9,12,18H,4-5,7-8,11H2 |
| InChIKey | GWDUZAASWBNGAD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |