C13H9ClN2O3S — CID 43364043
5-chloro-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]aniline (PubChem CID 43364043) has the molecular formula C13H9ClN2O3S and a molecular weight of 308.75 g/mol. Its IUPAC name is 5-chloro-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]aniline.
| Compound Name | 5-chloro-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]aniline |
|---|---|
| PubChem CID | 43364043 |
| Molecular Formula | C13H9ClN2O3S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 5-chloro-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]aniline |
| SMILES | Nc1cc(Cl)ccc1OC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H9ClN2O3S/c14-8-5-6-11(10(15)7-8)19-13-9-3-1-2-4-12(9)20(17,18)16-13/h1-7H,15H2 |
| InChIKey | IMSCPYCNTHLJAX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|