C10H10ClNO3S — CID 117061278
6-chloro-3-propan-2-yloxy-1,2-benzothiazole 1,1-dioxide (PubChem CID 117061278) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 6-chloro-3-propan-2-yloxy-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 6-chloro-3-propan-2-yloxy-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 117061278 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 6-chloro-3-propan-2-yloxy-1,2-benzothiazole 1,1-dioxide |
| SMILES | CC(C)OC1=NS(=O)(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H10ClNO3S/c1-6(2)15-10-8-4-3-7(11)5-9(8)16(13,14)12-10/h3-6H,1-2H3 |
| InChIKey | TVCXYHUOUDGFPV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |